C12H15N — CID 138625490
4,7,8-trimethyl-3,4-dihydroquinoline (PubChem CID 138625490) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 4,7,8-trimethyl-3,4-dihydroquinoline.
| Compound Name | 4,7,8-trimethyl-3,4-dihydroquinoline |
|---|---|
| PubChem CID | 138625490 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 4,7,8-trimethyl-3,4-dihydroquinoline |
| SMILES | Cc1ccc2c(c1C)N=CCC2C |
| InChI | InChI=1S/C12H15N/c1-8-4-5-11-9(2)6-7-13-12(11)10(8)3/h4-5,7,9H,6H2,1-3H3 |
| InChIKey | YZGUMIHRQBIGQF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |