About CID 138625623
CID 138625623 (PubChem CID 138625623) has the molecular formula C20H34O4
and a molecular weight of 338.49 g/mol.
Molecular Properties
| Compound Name | CID 138625623 |
| PubChem CID | 138625623 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | — |
| SMILES | CC1CC2CCCC(C2)C12OOC1(C[C@@H](O)C[C@H](C(C)(C)C)C1)O2 |
| InChI | InChI=1S/C20H34O4/c1-13-8-14-6-5-7-15(9-14)20(13)22-19(23-24-20)11-16(18(2,3)4)10-17(21)12-19/h13-17,21H,5-12H2,1-4H3/t13?,14?,15?,16-,17-,19?,20?/m0/s1 |
| InChIKey | USFKPOGZQGYCNG-BBLXNKIASA-N |
| XLogP | 4.41 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 138625623 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 138625623?
The IUPAC name of CID 138625623 (CID 138625623) is not available.
What is the SMILES notation for CID 138625623?
The canonical SMILES for CID 138625623 is CC1CC2CCCC(C2)C12OOC1(C[C@@H](O)C[C@H](C(C)(C)C)C1)O2.
What is the InChIKey of CID 138625623?
The InChIKey is USFKPOGZQGYCNG-BBLXNKIASA-N. The full InChI is InChI=1S/C20H34O4/c1-13-8-14-6-5-7-15(9-14)20(13)22-19(23-24-20)11-16(18(2,3)4)10-17(21)12-19/h13-17,21H,5-12H2,1-4H3/t13?,14?,15?,16-,17-,19?,20?/m0/s1.
What are the key properties of CID 138625623?
CID 138625623 has a molecular weight of 338.49 g/mol, XLogP of 4.41, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 138625623 is sourced from PubChem (CID 138625623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).