C24H19F2N5O4 — CID 138625958
2-[(1R,2R)-2-[3-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl]cyclohexyl]isoindole-1,3-dione (PubChem CID 138625958) has the molecular formula C24H19F2N5O4 and a molecular weight of 479.44 g/mol. Its IUPAC name is 2-[(1R,2R)-2-[3-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl]cyclohexyl]isoindole-1,3-dione.
| Compound Name | 2-[(1R,2R)-2-[3-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl]cyclohexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 138625958 |
| Molecular Formula | C24H19F2N5O4 |
| Molecular Weight | 479.44 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 2-[(1R,2R)-2-[3-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl]cyclohexyl]isoindole-1,3-dione |
| SMILES | O=C1c2cc(-c3nnc(C(F)F)o3)cnc2CN1[C@@H]1CCCC[C@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H19F2N5O4/c25-19(26)21-29-28-20(35-21)12-9-15-16(27-10-12)11-30(22(15)32)17-7-3-4-8-18(17)31-23(33)13-5-1-2-6-14(13)24(31)34/h1-2,5-6,9-10,17-19H,3-4,7-8,11H2/t17-,18-/m1/s1 |
| InChIKey | ICPGTOJHXIQWCH-QZTJIDSGSA-N |
| XLogP | 3.63 |
| TPSA | 109.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|