C18H18F9N3 — CID 138626041
(1Z,3E)-3-(trifluoromethyl)-1-[4-(trifluoromethyl)-6-[4-(trifluoromethyl)-1,2,3,6-tetrahydropyridin-2-yl]-1,2-dihydropyridin-2-yl]penta-1,3-dien-1-amine (PubChem CID 138626041) has the molecular formula C18H18F9N3 and a molecular weight of 447.35 g/mol. Its IUPAC name is (1Z,3E)-3-(trifluoromethyl)-1-[4-(trifluoromethyl)-6-[4-(trifluoromethyl)-1,2,3,6-tetrahydropyridin-2-yl]-1,2-dihydropyridin-2-yl]penta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-3-(trifluoromethyl)-1-[4-(trifluoromethyl)-6-[4-(trifluoromethyl)-1,2,3,6-tetrahydropyridin-2-yl]-1,2-dihydropyridin-2-yl]penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 138626041 |
| Molecular Formula | C18H18F9N3 |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | (1Z,3E)-3-(trifluoromethyl)-1-[4-(trifluoromethyl)-6-[4-(trifluoromethyl)-1,2,3,6-tetrahydropyridin-2-yl]-1,2-dihydropyridin-2-yl]penta-1,3-dien-1-amine |
| SMILES | C/C=C(\C=C(/N)C1C=C(C(F)(F)F)C=C(C2CC(C(F)(F)F)=CCN2)N1)C(F)(F)F |
| InChI | InChI=1S/C18H18F9N3/c1-2-9(16(19,20)21)5-12(28)13-7-11(18(25,26)27)8-15(30-13)14-6-10(3-4-29-14)17(22,23)24/h2-3,5,7-8,13-14,29-30H,4,6,28H2,1H3/b9-2+,12-5- |
| InChIKey | XQCXIEOWKGACEP-UOLIJDLOSA-N |
| XLogP | 4.53 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|