C19H20F9N3 — CID 138626042
(1Z,3E)-1-[1-methyl-4-(trifluoromethyl)-6-[4-(trifluoromethyl)-1,2,3,6-tetrahydropyridin-2-yl]-2H-pyridin-2-yl]-3-(trifluoromethyl)penta-1,3-dien-1-amine (PubChem CID 138626042) has the molecular formula C19H20F9N3 and a molecular weight of 461.37 g/mol. Its IUPAC name is (1Z,3E)-1-[1-methyl-4-(trifluoromethyl)-6-[4-(trifluoromethyl)-1,2,3,6-tetrahydropyridin-2-yl]-2H-pyridin-2-yl]-3-(trifluoromethyl)penta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-1-[1-methyl-4-(trifluoromethyl)-6-[4-(trifluoromethyl)-1,2,3,6-tetrahydropyridin-2-yl]-2H-pyridin-2-yl]-3-(trifluoromethyl)penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 138626042 |
| Molecular Formula | C19H20F9N3 |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | (1Z,3E)-1-[1-methyl-4-(trifluoromethyl)-6-[4-(trifluoromethyl)-1,2,3,6-tetrahydropyridin-2-yl]-2H-pyridin-2-yl]-3-(trifluoromethyl)penta-1,3-dien-1-amine |
| SMILES | C/C=C(\C=C(/N)C1C=C(C(F)(F)F)C=C(C2CC(C(F)(F)F)=CCN2)N1C)C(F)(F)F |
| InChI | InChI=1S/C19H20F9N3/c1-3-10(17(20,21)22)6-13(29)15-8-12(19(26,27)28)9-16(31(15)2)14-7-11(4-5-30-14)18(23,24)25/h3-4,6,8-9,14-15,30H,5,7,29H2,1-2H3/b10-3+,13-6- |
| InChIKey | CXIRNCQVKBBKRT-CAVFMPQDSA-N |
| XLogP | 4.87 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|