C22H36O6 — CID 138626106
methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-ethenyl-3-(oxan-2-yloxy)cyclopentyl]heptanoate (PubChem CID 138626106) has the molecular formula C22H36O6 and a molecular weight of 396.52 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-ethenyl-3-(oxan-2-yloxy)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-ethenyl-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 138626106 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-ethenyl-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
| SMILES | C=C[C@@H]1[C@@H](CCCCCCC(=O)OC)[C@@H](OC(C)=O)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C22H36O6/c1-4-17-18(11-7-5-6-8-12-21(24)25-3)20(27-16(2)23)15-19(17)28-22-13-9-10-14-26-22/h4,17-20,22H,1,5-15H2,2-3H3/t17-,18-,19-,20+,22?/m1/s1 |
| InChIKey | IZWCTWVKEKNDJW-LBZTZSLCSA-N |
| XLogP | 4.17 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|