About 1-[4-(2,2,2-trifluoroethylamino)piperidin-1-yl]ethanethiol
1-[4-(2,2,2-trifluoroethylamino)piperidin-1-yl]ethanethiol (PubChem CID 138626116) has the molecular formula C9H17F3N2S
and a molecular weight of 242.31 g/mol. Its IUPAC name is 1-[4-(2,2,2-trifluoroethylamino)piperidin-1-yl]ethanethiol.
Molecular Properties
| Compound Name | 1-[4-(2,2,2-trifluoroethylamino)piperidin-1-yl]ethanethiol |
| PubChem CID | 138626116 |
| Molecular Formula | C9H17F3N2S |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1-[4-(2,2,2-trifluoroethylamino)piperidin-1-yl]ethanethiol |
| SMILES | CC(S)N1CCC(NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H17F3N2S/c1-7(15)14-4-2-8(3-5-14)13-6-9(10,11)12/h7-8,13,15H,2-6H2,1H3 |
| InChIKey | PSUZLZSQIHFXKC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(2,2,2-trifluoroethylamino)piperidin-1-yl]ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,2,2-trifluoroethylamino)piperidin-1-yl]ethanethiol?
The IUPAC name of 1-[4-(2,2,2-trifluoroethylamino)piperidin-1-yl]ethanethiol (CID 138626116) is 1-[4-(2,2,2-trifluoroethylamino)piperidin-1-yl]ethanethiol.
What is the SMILES notation for 1-[4-(2,2,2-trifluoroethylamino)piperidin-1-yl]ethanethiol?
The canonical SMILES for 1-[4-(2,2,2-trifluoroethylamino)piperidin-1-yl]ethanethiol is CC(S)N1CCC(NCC(F)(F)F)CC1.
What is the InChIKey of 1-[4-(2,2,2-trifluoroethylamino)piperidin-1-yl]ethanethiol?
The InChIKey is PSUZLZSQIHFXKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3N2S/c1-7(15)14-4-2-8(3-5-14)13-6-9(10,11)12/h7-8,13,15H,2-6H2,1H3.
What are the key properties of 1-[4-(2,2,2-trifluoroethylamino)piperidin-1-yl]ethanethiol?
1-[4-(2,2,2-trifluoroethylamino)piperidin-1-yl]ethanethiol has a molecular weight of 242.31 g/mol, XLogP of 1.88, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,2,2-trifluoroethylamino)piperidin-1-yl]ethanethiol is sourced from PubChem (CID 138626116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).