C17H28N2 — CID 138626435
(9aR)-2-cyclohexyl-7,8-dimethyl-2,5,5a,6,9,9a-hexahydro-1H-1,4-benzodiazepine (PubChem CID 138626435) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is (9aR)-2-cyclohexyl-7,8-dimethyl-2,5,5a,6,9,9a-hexahydro-1H-1,4-benzodiazepine.
| Compound Name | (9aR)-2-cyclohexyl-7,8-dimethyl-2,5,5a,6,9,9a-hexahydro-1H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 138626435 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | (9aR)-2-cyclohexyl-7,8-dimethyl-2,5,5a,6,9,9a-hexahydro-1H-1,4-benzodiazepine |
| SMILES | CC1=C(C)C[C@H]2NC(C3CCCCC3)C=NCC2C1 |
| InChI | InChI=1S/C17H28N2/c1-12-8-15-10-18-11-17(14-6-4-3-5-7-14)19-16(15)9-13(12)2/h11,14-17,19H,3-10H2,1-2H3/t15?,16-,17?/m1/s1 |
| InChIKey | DZRIMDWFEQPHHE-AQFXKWCLSA-N |
| XLogP | 3.72 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|