About 5-[1-(5-ethyl-1,3-thiazol-2-yl)propan-2-yl]-1,2-oxazole
5-[1-(5-ethyl-1,3-thiazol-2-yl)propan-2-yl]-1,2-oxazole (PubChem CID 138626517) has the molecular formula C11H14N2OS
and a molecular weight of 222.31 g/mol. Its IUPAC name is 5-[1-(5-ethyl-1,3-thiazol-2-yl)propan-2-yl]-1,2-oxazole.
Molecular Properties
| Compound Name | 5-[1-(5-ethyl-1,3-thiazol-2-yl)propan-2-yl]-1,2-oxazole |
| PubChem CID | 138626517 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 5-[1-(5-ethyl-1,3-thiazol-2-yl)propan-2-yl]-1,2-oxazole |
| SMILES | CCc1cnc(CC(C)c2ccno2)s1 |
| InChI | InChI=1S/C11H14N2OS/c1-3-9-7-12-11(15-9)6-8(2)10-4-5-13-14-10/h4-5,7-8H,3,6H2,1-2H3 |
| InChIKey | GBFFRFBUAVJZSR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[1-(5-ethyl-1,3-thiazol-2-yl)propan-2-yl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(5-ethyl-1,3-thiazol-2-yl)propan-2-yl]-1,2-oxazole?
The IUPAC name of 5-[1-(5-ethyl-1,3-thiazol-2-yl)propan-2-yl]-1,2-oxazole (CID 138626517) is 5-[1-(5-ethyl-1,3-thiazol-2-yl)propan-2-yl]-1,2-oxazole.
What is the SMILES notation for 5-[1-(5-ethyl-1,3-thiazol-2-yl)propan-2-yl]-1,2-oxazole?
The canonical SMILES for 5-[1-(5-ethyl-1,3-thiazol-2-yl)propan-2-yl]-1,2-oxazole is CCc1cnc(CC(C)c2ccno2)s1.
What is the InChIKey of 5-[1-(5-ethyl-1,3-thiazol-2-yl)propan-2-yl]-1,2-oxazole?
The InChIKey is GBFFRFBUAVJZSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2OS/c1-3-9-7-12-11(15-9)6-8(2)10-4-5-13-14-10/h4-5,7-8H,3,6H2,1-2H3.
What are the key properties of 5-[1-(5-ethyl-1,3-thiazol-2-yl)propan-2-yl]-1,2-oxazole?
5-[1-(5-ethyl-1,3-thiazol-2-yl)propan-2-yl]-1,2-oxazole has a molecular weight of 222.31 g/mol, XLogP of 3.04, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(5-ethyl-1,3-thiazol-2-yl)propan-2-yl]-1,2-oxazole is sourced from PubChem (CID 138626517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).