C24H26BrN7O3 — CID 138626866
1-[2-[(1R,3S,5R)-3-[2-[amino-(6-bromo-2-pyridinyl)amino]-2-oxoethyl]-2-azabicyclo[3.2.0]heptan-2-yl]-2-oxoethyl]-5-methylindazole-3-carboxamide (PubChem CID 138626866) has the molecular formula C24H26BrN7O3 and a molecular weight of 540.42 g/mol. Its IUPAC name is 1-[2-[(1R,3S,5R)-3-[2-[amino-(6-bromo-2-pyridinyl)amino]-2-oxoethyl]-2-azabicyclo[3.2.0]heptan-2-yl]-2-oxoethyl]-5-methylindazole-3-carboxamide.
| Compound Name | 1-[2-[(1R,3S,5R)-3-[2-[amino-(6-bromo-2-pyridinyl)amino]-2-oxoethyl]-2-azabicyclo[3.2.0]heptan-2-yl]-2-oxoethyl]-5-methylindazole-3-carboxamide |
|---|---|
| PubChem CID | 138626866 |
| Molecular Formula | C24H26BrN7O3 |
| Molecular Weight | 540.42 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | 1-[2-[(1R,3S,5R)-3-[2-[amino-(6-bromo-2-pyridinyl)amino]-2-oxoethyl]-2-azabicyclo[3.2.0]heptan-2-yl]-2-oxoethyl]-5-methylindazole-3-carboxamide |
| SMILES | Cc1ccc2c(c1)c(C(N)=O)nn2CC(=O)N1[C@H](CC(=O)N(N)c2cccc(Br)n2)C[C@H]2CC[C@H]21 |
| InChI | InChI=1S/C24H26BrN7O3/c1-13-5-7-18-16(9-13)23(24(26)35)29-30(18)12-22(34)31-15(10-14-6-8-17(14)31)11-21(33)32(27)20-4-2-3-19(25)28-20/h2-5,7,9,14-15,17H,6,8,10-12,27H2,1H3,(H2,26,35)/t14-,15+,17-/m1/s1 |
| InChIKey | UZUCUBDDYLBFPM-HLLBOEOZSA-N |
| XLogP | 2.28 |
| TPSA | 140.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|