C13H23FO — CID 138627533
3-(2,2-dimethylpropyl)-4-fluoro-1-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan (PubChem CID 138627533) has the molecular formula C13H23FO and a molecular weight of 214.32 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-4-fluoro-1-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan.
| Compound Name | 3-(2,2-dimethylpropyl)-4-fluoro-1-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan |
|---|---|
| PubChem CID | 138627533 |
| Molecular Formula | C13H23FO |
| Molecular Weight | 214.32 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-4-fluoro-1-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan |
| SMILES | CC1OC(CC(C)(C)C)C2C(F)CCC12 |
| InChI | InChI=1S/C13H23FO/c1-8-9-5-6-10(14)12(9)11(15-8)7-13(2,3)4/h8-12H,5-7H2,1-4H3 |
| InChIKey | DCTNTSYMKWHYMK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |