C18H26N2O4S — CID 138628017
1-[1-(1,3-benzodioxol-5-ylsulfonyl)piperidin-4-yl]-4-methylpiperidine (PubChem CID 138628017) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-ylsulfonyl)piperidin-4-yl]-4-methylpiperidine.
| Compound Name | 1-[1-(1,3-benzodioxol-5-ylsulfonyl)piperidin-4-yl]-4-methylpiperidine |
|---|---|
| PubChem CID | 138628017 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-ylsulfonyl)piperidin-4-yl]-4-methylpiperidine |
| SMILES | CC1CCN(C2CCN(S(=O)(=O)c3ccc4c(c3)OCO4)CC2)CC1 |
| InChI | InChI=1S/C18H26N2O4S/c1-14-4-8-19(9-5-14)15-6-10-20(11-7-15)25(21,22)16-2-3-17-18(12-16)24-13-23-17/h2-3,12,14-15H,4-11,13H2,1H3 |
| InChIKey | YCTNQZQYWKEYOQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |