C9H8F6N2O — CID 138628082
4-(2,2,3,4,4,4-hexafluorobutoxy)-6-methylpyrimidine (PubChem CID 138628082) has the molecular formula C9H8F6N2O and a molecular weight of 274.16 g/mol. Its IUPAC name is 4-(2,2,3,4,4,4-hexafluorobutoxy)-6-methylpyrimidine.
| Compound Name | 4-(2,2,3,4,4,4-hexafluorobutoxy)-6-methylpyrimidine |
|---|---|
| PubChem CID | 138628082 |
| Molecular Formula | C9H8F6N2O |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 4-(2,2,3,4,4,4-hexafluorobutoxy)-6-methylpyrimidine |
| SMILES | Cc1cc(OCC(F)(F)C(F)C(F)(F)F)ncn1 |
| InChI | InChI=1S/C9H8F6N2O/c1-5-2-6(17-4-16-5)18-3-8(11,12)7(10)9(13,14)15/h2,4,7H,3H2,1H3 |
| InChIKey | GACBDOVMMVDEER-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |