C13H20S — CID 138628384
(3Z,5Z,9E)-10-methylsulfanyldodeca-1,3,5,9-tetraene (PubChem CID 138628384) has the molecular formula C13H20S and a molecular weight of 208.37 g/mol. Its IUPAC name is (3Z,5Z,9E)-10-methylsulfanyldodeca-1,3,5,9-tetraene.
| Compound Name | (3Z,5Z,9E)-10-methylsulfanyldodeca-1,3,5,9-tetraene |
|---|---|
| PubChem CID | 138628384 |
| Molecular Formula | C13H20S |
| Molecular Weight | 208.37 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | (3Z,5Z,9E)-10-methylsulfanyldodeca-1,3,5,9-tetraene |
| SMILES | C=C/C=C\C=C/CC/C=C(\CC)SC |
| InChI | InChI=1S/C13H20S/c1-4-6-7-8-9-10-11-12-13(5-2)14-3/h4,6-9,12H,1,5,10-11H2,2-3H3/b7-6-,9-8-,13-12+ |
| InChIKey | FVADPFFLMYVLSS-ZNUVYLHDSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|