About (Z)-4,4,4-trifluoro-3-prop-1-en-2-yliminobut-1-en-1-amine
(Z)-4,4,4-trifluoro-3-prop-1-en-2-yliminobut-1-en-1-amine (PubChem CID 138628399) has the molecular formula C7H9F3N2
and a molecular weight of 178.16 g/mol. Its IUPAC name is (Z)-4,4,4-trifluoro-3-prop-1-en-2-yliminobut-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-4,4,4-trifluoro-3-prop-1-en-2-yliminobut-1-en-1-amine |
| PubChem CID | 138628399 |
| Molecular Formula | C7H9F3N2 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | (Z)-4,4,4-trifluoro-3-prop-1-en-2-yliminobut-1-en-1-amine |
| SMILES | C=C(C)/N=C(/C=C\N)C(F)(F)F |
| InChI | InChI=1S/C7H9F3N2/c1-5(2)12-6(3-4-11)7(8,9)10/h3-4H,1,11H2,2H3/b4-3-,12-6- |
| InChIKey | RXSBRSUYGXQQNQ-HLTLCVLOSA-N |
| XLogP | 2.00 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4,4,4-trifluoro-3-prop-1-en-2-yliminobut-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4,4,4-trifluoro-3-prop-1-en-2-yliminobut-1-en-1-amine?
The IUPAC name of (Z)-4,4,4-trifluoro-3-prop-1-en-2-yliminobut-1-en-1-amine (CID 138628399) is (Z)-4,4,4-trifluoro-3-prop-1-en-2-yliminobut-1-en-1-amine.
What is the SMILES notation for (Z)-4,4,4-trifluoro-3-prop-1-en-2-yliminobut-1-en-1-amine?
The canonical SMILES for (Z)-4,4,4-trifluoro-3-prop-1-en-2-yliminobut-1-en-1-amine is C=C(C)/N=C(/C=C\N)C(F)(F)F.
What is the InChIKey of (Z)-4,4,4-trifluoro-3-prop-1-en-2-yliminobut-1-en-1-amine?
The InChIKey is RXSBRSUYGXQQNQ-HLTLCVLOSA-N. The full InChI is InChI=1S/C7H9F3N2/c1-5(2)12-6(3-4-11)7(8,9)10/h3-4H,1,11H2,2H3/b4-3-,12-6-.
What are the key properties of (Z)-4,4,4-trifluoro-3-prop-1-en-2-yliminobut-1-en-1-amine?
(Z)-4,4,4-trifluoro-3-prop-1-en-2-yliminobut-1-en-1-amine has a molecular weight of 178.16 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4,4,4-trifluoro-3-prop-1-en-2-yliminobut-1-en-1-amine is sourced from PubChem (CID 138628399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).