C26H21F2N5O3 — CID 138628688
7-amino-3-(1-but-2-ynoylpyrrolidin-3-yl)-1-[4-(2,6-difluorophenoxy)phenyl]-5H-pyrrolo[2,3-d]pyridazin-4-one (PubChem CID 138628688) has the molecular formula C26H21F2N5O3 and a molecular weight of 489.48 g/mol. Its IUPAC name is 7-amino-3-(1-but-2-ynoylpyrrolidin-3-yl)-1-[4-(2,6-difluorophenoxy)phenyl]-5H-pyrrolo[2,3-d]pyridazin-4-one.
| Compound Name | 7-amino-3-(1-but-2-ynoylpyrrolidin-3-yl)-1-[4-(2,6-difluorophenoxy)phenyl]-5H-pyrrolo[2,3-d]pyridazin-4-one |
|---|---|
| PubChem CID | 138628688 |
| Molecular Formula | C26H21F2N5O3 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 7-amino-3-(1-but-2-ynoylpyrrolidin-3-yl)-1-[4-(2,6-difluorophenoxy)phenyl]-5H-pyrrolo[2,3-d]pyridazin-4-one |
| SMILES | CC#CC(=O)N1CCC(c2cn(-c3ccc(Oc4c(F)cccc4F)cc3)c3c(N)n[nH]c(=O)c23)C1 |
| InChI | InChI=1S/C26H21F2N5O3/c1-2-4-21(34)32-12-11-15(13-32)18-14-33(23-22(18)26(35)31-30-25(23)29)16-7-9-17(10-8-16)36-24-19(27)5-3-6-20(24)28/h3,5-10,14-15H,11-13H2,1H3,(H2,29,30)(H,31,35) |
| InChIKey | LMSZKRSNARUUMF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|