C24H32F8 — CID 138629058
1,2-dimethyl-4-(4-methyl-3-methylidenepent-4-enyl)-2-[1,2,2,3-tetrafluoro-3-(3,4,5,5-tetrafluoro-2,4-dimethylhexan-3-yl)cyclopropyl]bicyclo[1.1.0]butane (PubChem CID 138629058) has the molecular formula C24H32F8 and a molecular weight of 472.50 g/mol. Its IUPAC name is 1,2-dimethyl-4-(4-methyl-3-methylidenepent-4-enyl)-2-[1,2,2,3-tetrafluoro-3-(3,4,5,5-tetrafluoro-2,4-dimethylhexan-3-yl)cyclopropyl]bicyclo[1.1.0]butane.
| Compound Name | 1,2-dimethyl-4-(4-methyl-3-methylidenepent-4-enyl)-2-[1,2,2,3-tetrafluoro-3-(3,4,5,5-tetrafluoro-2,4-dimethylhexan-3-yl)cyclopropyl]bicyclo[1.1.0]butane |
|---|---|
| PubChem CID | 138629058 |
| Molecular Formula | C24H32F8 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 1,2-dimethyl-4-(4-methyl-3-methylidenepent-4-enyl)-2-[1,2,2,3-tetrafluoro-3-(3,4,5,5-tetrafluoro-2,4-dimethylhexan-3-yl)cyclopropyl]bicyclo[1.1.0]butane |
| SMILES | C=C(C)C(=C)CCC1C2C1(C)C2(C)C1(F)C(F)(F)C1(F)C(F)(C(C)C)C(C)(F)C(C)(F)F |
| InChI | InChI=1S/C24H32F8/c1-12(2)14(5)10-11-15-16-17(15,6)18(16,7)22(29)23(30,24(22,31)32)21(28,13(3)4)19(8,25)20(9,26)27/h13,15-16H,1,5,10-11H2,2-4,6-9H3 |
| InChIKey | ZICJCCLAUFJBFC-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|