About 3-chloro-5-[4-[2,6-di(propan-2-yl)phenyl]pyrazol-1-yl]phenol
3-chloro-5-[4-[2,6-di(propan-2-yl)phenyl]pyrazol-1-yl]phenol (PubChem CID 138629061) has the molecular formula C21H23ClN2O
and a molecular weight of 354.88 g/mol. Its IUPAC name is 3-chloro-5-[4-[2,6-di(propan-2-yl)phenyl]pyrazol-1-yl]phenol.
Molecular Properties
| Compound Name | 3-chloro-5-[4-[2,6-di(propan-2-yl)phenyl]pyrazol-1-yl]phenol |
| PubChem CID | 138629061 |
| Molecular Formula | C21H23ClN2O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 3-chloro-5-[4-[2,6-di(propan-2-yl)phenyl]pyrazol-1-yl]phenol |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1cnn(-c2cc(O)cc(Cl)c2)c1 |
| InChI | InChI=1S/C21H23ClN2O/c1-13(2)19-6-5-7-20(14(3)4)21(19)15-11-23-24(12-15)17-8-16(22)9-18(25)10-17/h5-14,25H,1-4H3 |
| InChIKey | WTUYXWLQIRWPCN-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-5-[4-[2,6-di(propan-2-yl)phenyl]pyrazol-1-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-[4-[2,6-di(propan-2-yl)phenyl]pyrazol-1-yl]phenol?
The IUPAC name of 3-chloro-5-[4-[2,6-di(propan-2-yl)phenyl]pyrazol-1-yl]phenol (CID 138629061) is 3-chloro-5-[4-[2,6-di(propan-2-yl)phenyl]pyrazol-1-yl]phenol.
What is the SMILES notation for 3-chloro-5-[4-[2,6-di(propan-2-yl)phenyl]pyrazol-1-yl]phenol?
The canonical SMILES for 3-chloro-5-[4-[2,6-di(propan-2-yl)phenyl]pyrazol-1-yl]phenol is CC(C)c1cccc(C(C)C)c1-c1cnn(-c2cc(O)cc(Cl)c2)c1.
What is the InChIKey of 3-chloro-5-[4-[2,6-di(propan-2-yl)phenyl]pyrazol-1-yl]phenol?
The InChIKey is WTUYXWLQIRWPCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23ClN2O/c1-13(2)19-6-5-7-20(14(3)4)21(19)15-11-23-24(12-15)17-8-16(22)9-18(25)10-17/h5-14,25H,1-4H3.
What are the key properties of 3-chloro-5-[4-[2,6-di(propan-2-yl)phenyl]pyrazol-1-yl]phenol?
3-chloro-5-[4-[2,6-di(propan-2-yl)phenyl]pyrazol-1-yl]phenol has a molecular weight of 354.88 g/mol, XLogP of 6.15, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-[4-[2,6-di(propan-2-yl)phenyl]pyrazol-1-yl]phenol is sourced from PubChem (CID 138629061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).