C9H10F2O2 — CID 138629169
2,2-difluoro-4-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]-1,3-dioxole (PubChem CID 138629169) has the molecular formula C9H10F2O2 and a molecular weight of 188.17 g/mol. Its IUPAC name is 2,2-difluoro-4-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]-1,3-dioxole.
| Compound Name | 2,2-difluoro-4-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]-1,3-dioxole |
|---|---|
| PubChem CID | 138629169 |
| Molecular Formula | C9H10F2O2 |
| Molecular Weight | 188.17 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 2,2-difluoro-4-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]-1,3-dioxole |
| SMILES | C=C(C)/C=C\C1=C(C)OC(F)(F)O1 |
| InChI | InChI=1S/C9H10F2O2/c1-6(2)4-5-8-7(3)12-9(10,11)13-8/h4-5H,1H2,2-3H3/b5-4- |
| InChIKey | LDPFOLRORRHBHN-PLNGDYQASA-N |
| XLogP | 2.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.17 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|