C21H28O5S — CID 138629175
[(2R,3aR,5R,7aS)-2-[2-(benzenesulfonyl)ethyl]-5-(2-methylbuta-2,3-dienyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-3a-yl]methanol (PubChem CID 138629175) has the molecular formula C21H28O5S and a molecular weight of 392.52 g/mol. Its IUPAC name is [(2R,3aR,5R,7aS)-2-[2-(benzenesulfonyl)ethyl]-5-(2-methylbuta-2,3-dienyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-3a-yl]methanol.
| Compound Name | [(2R,3aR,5R,7aS)-2-[2-(benzenesulfonyl)ethyl]-5-(2-methylbuta-2,3-dienyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-3a-yl]methanol |
|---|---|
| PubChem CID | 138629175 |
| Molecular Formula | C21H28O5S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | [(2R,3aR,5R,7aS)-2-[2-(benzenesulfonyl)ethyl]-5-(2-methylbuta-2,3-dienyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-3a-yl]methanol |
| SMILES | C=C=C(C)C[C@H]1CC[C@@H]2O[C@@H](CCS(=O)(=O)c3ccccc3)C[C@]2(CO)O1 |
| InChI | InChI=1S/C21H28O5S/c1-3-16(2)13-17-9-10-20-21(15-22,26-17)14-18(25-20)11-12-27(23,24)19-7-5-4-6-8-19/h4-8,17-18,20,22H,1,9-15H2,2H3/t17-,18+,20+,21-/m1/s1 |
| InChIKey | MLUHDRQHFMAMFL-YXYSEUPNSA-N |
| XLogP | 3.04 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |