C15H24O5 — CID 138629180
4-[(1R,3R,6S,8R,9R)-9-methoxy-2,7,10-trioxatricyclo[6.3.1.01,6]dodecan-3-yl]-3-methylbutan-2-one (PubChem CID 138629180) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is 4-[(1R,3R,6S,8R,9R)-9-methoxy-2,7,10-trioxatricyclo[6.3.1.01,6]dodecan-3-yl]-3-methylbutan-2-one.
| Compound Name | 4-[(1R,3R,6S,8R,9R)-9-methoxy-2,7,10-trioxatricyclo[6.3.1.01,6]dodecan-3-yl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 138629180 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 4-[(1R,3R,6S,8R,9R)-9-methoxy-2,7,10-trioxatricyclo[6.3.1.01,6]dodecan-3-yl]-3-methylbutan-2-one |
| SMILES | CO[C@@H]1OC[C@]23C[C@H]1O[C@H]2CC[C@H](CC(C)C(C)=O)O3 |
| InChI | InChI=1S/C15H24O5/c1-9(10(2)16)6-11-4-5-13-15(20-11)7-12(19-13)14(17-3)18-8-15/h9,11-14H,4-8H2,1-3H3/t9?,11-,12-,13+,14-,15-/m1/s1 |
| InChIKey | ROAVBASDTHSFMN-UPRNZLQGSA-N |
| XLogP | 1.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |