About N-methyl-N-[(E)-1,1,1-trifluorohex-5-en-2-ylideneamino]methanamine
N-methyl-N-[(E)-1,1,1-trifluorohex-5-en-2-ylideneamino]methanamine (PubChem CID 138629389) has the molecular formula C8H13F3N2
and a molecular weight of 194.20 g/mol. Its IUPAC name is N-methyl-N-[(E)-1,1,1-trifluorohex-5-en-2-ylideneamino]methanamine.
Molecular Properties
| Compound Name | N-methyl-N-[(E)-1,1,1-trifluorohex-5-en-2-ylideneamino]methanamine |
| PubChem CID | 138629389 |
| Molecular Formula | C8H13F3N2 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | N-methyl-N-[(E)-1,1,1-trifluorohex-5-en-2-ylideneamino]methanamine |
| SMILES | C=CCC/C(=N\N(C)C)C(F)(F)F |
| InChI | InChI=1S/C8H13F3N2/c1-4-5-6-7(8(9,10)11)12-13(2)3/h4H,1,5-6H2,2-3H3/b12-7+ |
| InChIKey | LIBYNQQFAJDGAD-KPKJPENVSA-N |
| XLogP | 2.43 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-[(E)-1,1,1-trifluorohex-5-en-2-ylideneamino]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(E)-1,1,1-trifluorohex-5-en-2-ylideneamino]methanamine?
The IUPAC name of N-methyl-N-[(E)-1,1,1-trifluorohex-5-en-2-ylideneamino]methanamine (CID 138629389) is N-methyl-N-[(E)-1,1,1-trifluorohex-5-en-2-ylideneamino]methanamine.
What is the SMILES notation for N-methyl-N-[(E)-1,1,1-trifluorohex-5-en-2-ylideneamino]methanamine?
The canonical SMILES for N-methyl-N-[(E)-1,1,1-trifluorohex-5-en-2-ylideneamino]methanamine is C=CCC/C(=N\N(C)C)C(F)(F)F.
What is the InChIKey of N-methyl-N-[(E)-1,1,1-trifluorohex-5-en-2-ylideneamino]methanamine?
The InChIKey is LIBYNQQFAJDGAD-KPKJPENVSA-N. The full InChI is InChI=1S/C8H13F3N2/c1-4-5-6-7(8(9,10)11)12-13(2)3/h4H,1,5-6H2,2-3H3/b12-7+.
What are the key properties of N-methyl-N-[(E)-1,1,1-trifluorohex-5-en-2-ylideneamino]methanamine?
N-methyl-N-[(E)-1,1,1-trifluorohex-5-en-2-ylideneamino]methanamine has a molecular weight of 194.20 g/mol, XLogP of 2.43, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(E)-1,1,1-trifluorohex-5-en-2-ylideneamino]methanamine is sourced from PubChem (CID 138629389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).