About pyrimidine-2,4,6-triamine
pyrimidine-2,4,6-triamine (PubChem CID 13863) has the molecular formula C4H7N5
and a molecular weight of 125.13 g/mol. Its IUPAC name is pyrimidine-2,4,6-triamine.
Molecular Properties
| Compound Name | pyrimidine-2,4,6-triamine |
| PubChem CID | 13863 |
| Molecular Formula | C4H7N5 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.07 |
| IUPAC Name | pyrimidine-2,4,6-triamine |
| SMILES | Nc1cc(N)nc(N)n1 |
| InChI | InChI=1S/C4H7N5/c5-2-1-3(6)9-4(7)8-2/h1H,(H6,5,6,7,8,9) |
| InChIKey | JTTIOYHBNXDJOD-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze pyrimidine-2,4,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimidine-2,4,6-triamine?
The IUPAC name of pyrimidine-2,4,6-triamine (CID 13863) is pyrimidine-2,4,6-triamine.
What is the SMILES notation for pyrimidine-2,4,6-triamine?
The canonical SMILES for pyrimidine-2,4,6-triamine is Nc1cc(N)nc(N)n1.
What is the InChIKey of pyrimidine-2,4,6-triamine?
The InChIKey is JTTIOYHBNXDJOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N5/c5-2-1-3(6)9-4(7)8-2/h1H,(H6,5,6,7,8,9).
What are the key properties of pyrimidine-2,4,6-triamine?
pyrimidine-2,4,6-triamine has a molecular weight of 125.13 g/mol, XLogP of -0.78, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimidine-2,4,6-triamine is sourced from PubChem (CID 13863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).