C14H28N2 — CID 138630196
N'-methyl-N-[(Z)-4,4,6,7-tetramethyloct-2-en-3-yl]methanimidamide (PubChem CID 138630196) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is N'-methyl-N-[(Z)-4,4,6,7-tetramethyloct-2-en-3-yl]methanimidamide.
| Compound Name | N'-methyl-N-[(Z)-4,4,6,7-tetramethyloct-2-en-3-yl]methanimidamide |
|---|---|
| PubChem CID | 138630196 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | N'-methyl-N-[(Z)-4,4,6,7-tetramethyloct-2-en-3-yl]methanimidamide |
| SMILES | C/C=C(\N/C=N/C)C(C)(C)CC(C)C(C)C |
| InChI | InChI=1S/C14H28N2/c1-8-13(16-10-15-7)14(5,6)9-12(4)11(2)3/h8,10-12H,9H2,1-7H3,(H,15,16)/b13-8- |
| InChIKey | OLQPIPRIZFHXFY-JYRVWZFOSA-N |
| XLogP | 3.85 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|