C24H26N6OS2 — CID 138630391
3-[6-[[(5-amino-1,3,4-thiadiazol-2-yl)amino]methyl]-1-(2-methyloxan-4-yl)indol-3-yl]benzenecarbothioamide (PubChem CID 138630391) has the molecular formula C24H26N6OS2 and a molecular weight of 478.65 g/mol. Its IUPAC name is 3-[6-[[(5-amino-1,3,4-thiadiazol-2-yl)amino]methyl]-1-(2-methyloxan-4-yl)indol-3-yl]benzenecarbothioamide.
| Compound Name | 3-[6-[[(5-amino-1,3,4-thiadiazol-2-yl)amino]methyl]-1-(2-methyloxan-4-yl)indol-3-yl]benzenecarbothioamide |
|---|---|
| PubChem CID | 138630391 |
| Molecular Formula | C24H26N6OS2 |
| Molecular Weight | 478.65 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 3-[6-[[(5-amino-1,3,4-thiadiazol-2-yl)amino]methyl]-1-(2-methyloxan-4-yl)indol-3-yl]benzenecarbothioamide |
| SMILES | CC1CC(n2cc(-c3cccc(C(N)=S)c3)c3ccc(CNc4nnc(N)s4)cc32)CCO1 |
| InChI | InChI=1S/C24H26N6OS2/c1-14-9-18(7-8-31-14)30-13-20(16-3-2-4-17(11-16)22(25)32)19-6-5-15(10-21(19)30)12-27-24-29-28-23(26)33-24/h2-6,10-11,13-14,18H,7-9,12H2,1H3,(H2,25,32)(H2,26,28)(H,27,29) |
| InChIKey | MQMOAPULHOWYCF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.65 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|