About 3-[1-(4,4-difluorocyclohexyl)-6-(methanesulfonamido)indol-3-yl]benzenecarbothioamide
3-[1-(4,4-difluorocyclohexyl)-6-(methanesulfonamido)indol-3-yl]benzenecarbothioamide (PubChem CID 138630511) has the molecular formula C22H23F2N3O2S2
and a molecular weight of 463.58 g/mol. Its IUPAC name is 3-[1-(4,4-difluorocyclohexyl)-6-(methanesulfonamido)indol-3-yl]benzenecarbothioamide.
Molecular Properties
| Compound Name | 3-[1-(4,4-difluorocyclohexyl)-6-(methanesulfonamido)indol-3-yl]benzenecarbothioamide |
| PubChem CID | 138630511 |
| Molecular Formula | C22H23F2N3O2S2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 3-[1-(4,4-difluorocyclohexyl)-6-(methanesulfonamido)indol-3-yl]benzenecarbothioamide |
| SMILES | CS(=O)(=O)Nc1ccc2c(-c3cccc(C(N)=S)c3)cn(C3CCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/C22H23F2N3O2S2/c1-31(28,29)26-16-5-6-18-19(14-3-2-4-15(11-14)21(25)30)13-27(20(18)12-16)17-7-9-22(23,24)10-8-17/h2-6,11-13,17,26H,7-10H2,1H3,(H2,25,30) |
| InChIKey | OHBNKJGGSSRVEX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-(4,4-difluorocyclohexyl)-6-(methanesulfonamido)indol-3-yl]benzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(4,4-difluorocyclohexyl)-6-(methanesulfonamido)indol-3-yl]benzenecarbothioamide?
The IUPAC name of 3-[1-(4,4-difluorocyclohexyl)-6-(methanesulfonamido)indol-3-yl]benzenecarbothioamide (CID 138630511) is 3-[1-(4,4-difluorocyclohexyl)-6-(methanesulfonamido)indol-3-yl]benzenecarbothioamide.
What is the SMILES notation for 3-[1-(4,4-difluorocyclohexyl)-6-(methanesulfonamido)indol-3-yl]benzenecarbothioamide?
The canonical SMILES for 3-[1-(4,4-difluorocyclohexyl)-6-(methanesulfonamido)indol-3-yl]benzenecarbothioamide is CS(=O)(=O)Nc1ccc2c(-c3cccc(C(N)=S)c3)cn(C3CCC(F)(F)CC3)c2c1.
What is the InChIKey of 3-[1-(4,4-difluorocyclohexyl)-6-(methanesulfonamido)indol-3-yl]benzenecarbothioamide?
The InChIKey is OHBNKJGGSSRVEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23F2N3O2S2/c1-31(28,29)26-16-5-6-18-19(14-3-2-4-15(11-14)21(25)30)13-27(20(18)12-16)17-7-9-22(23,24)10-8-17/h2-6,11-13,17,26H,7-10H2,1H3,(H2,25,30).
What are the key properties of 3-[1-(4,4-difluorocyclohexyl)-6-(methanesulfonamido)indol-3-yl]benzenecarbothioamide?
3-[1-(4,4-difluorocyclohexyl)-6-(methanesulfonamido)indol-3-yl]benzenecarbothioamide has a molecular weight of 463.58 g/mol, XLogP of 5.06, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(4,4-difluorocyclohexyl)-6-(methanesulfonamido)indol-3-yl]benzenecarbothioamide is sourced from PubChem (CID 138630511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).