C28H30N4O4 — CID 138630548
ethyl 4-[4-cyano-2-[[(1'R,4S)-6-(5-methyl-1,3,4-oxadiazol-2-yl)spiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-yl]methylamino]phenyl]butanoate (PubChem CID 138630548) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is ethyl 4-[4-cyano-2-[[(1'R,4S)-6-(5-methyl-1,3,4-oxadiazol-2-yl)spiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-yl]methylamino]phenyl]butanoate.
| Compound Name | ethyl 4-[4-cyano-2-[[(1'R,4S)-6-(5-methyl-1,3,4-oxadiazol-2-yl)spiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-yl]methylamino]phenyl]butanoate |
|---|---|
| PubChem CID | 138630548 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | ethyl 4-[4-cyano-2-[[(1'R,4S)-6-(5-methyl-1,3,4-oxadiazol-2-yl)spiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-yl]methylamino]phenyl]butanoate |
| SMILES | CCOC(=O)CCCc1ccc(C#N)cc1NC[C@@H]1C[C@]12CCOc1ccc(-c3nnc(C)o3)cc12 |
| InChI | InChI=1S/C28H30N4O4/c1-3-34-26(33)6-4-5-20-8-7-19(16-29)13-24(20)30-17-22-15-28(22)11-12-35-25-10-9-21(14-23(25)28)27-32-31-18(2)36-27/h7-10,13-14,22,30H,3-6,11-12,15,17H2,1-2H3/t22-,28+/m0/s1 |
| InChIKey | NYWXZWZNEZVFER-RBISFHTESA-N |
| XLogP | 4.95 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |