About propan-2-yl N-[2-[[2-[[2-[[2-(tert-butylamino)acetyl]amino]acetyl]amino]acetyl]amino]ethyl]carbamate
propan-2-yl N-[2-[[2-[[2-[[2-(tert-butylamino)acetyl]amino]acetyl]amino]acetyl]amino]ethyl]carbamate (PubChem CID 138630558) has the molecular formula C16H31N5O5
and a molecular weight of 373.45 g/mol. Its IUPAC name is propan-2-yl N-[2-[[2-[[2-[[2-(tert-butylamino)acetyl]amino]acetyl]amino]acetyl]amino]ethyl]carbamate.
Molecular Properties
| Compound Name | propan-2-yl N-[2-[[2-[[2-[[2-(tert-butylamino)acetyl]amino]acetyl]amino]acetyl]amino]ethyl]carbamate |
| PubChem CID | 138630558 |
| Molecular Formula | C16H31N5O5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | propan-2-yl N-[2-[[2-[[2-[[2-(tert-butylamino)acetyl]amino]acetyl]amino]acetyl]amino]ethyl]carbamate |
| SMILES | CC(C)OC(=O)NCCNC(=O)CNC(=O)CNC(=O)CNC(C)(C)C |
| InChI | InChI=1S/C16H31N5O5/c1-11(2)26-15(25)18-7-6-17-12(22)8-19-13(23)9-20-14(24)10-21-16(3,4)5/h11,21H,6-10H2,1-5H3,(H,17,22)(H,18,25)(H,19,23)(H,20,24) |
| InChIKey | BICYVLFKLXHCKO-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 137.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl N-[2-[[2-[[2-[[2-(tert-butylamino)acetyl]amino]acetyl]amino]acetyl]amino]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-[2-[[2-[[2-[[2-(tert-butylamino)acetyl]amino]acetyl]amino]acetyl]amino]ethyl]carbamate?
The IUPAC name of propan-2-yl N-[2-[[2-[[2-[[2-(tert-butylamino)acetyl]amino]acetyl]amino]acetyl]amino]ethyl]carbamate (CID 138630558) is propan-2-yl N-[2-[[2-[[2-[[2-(tert-butylamino)acetyl]amino]acetyl]amino]acetyl]amino]ethyl]carbamate.
What is the SMILES notation for propan-2-yl N-[2-[[2-[[2-[[2-(tert-butylamino)acetyl]amino]acetyl]amino]acetyl]amino]ethyl]carbamate?
The canonical SMILES for propan-2-yl N-[2-[[2-[[2-[[2-(tert-butylamino)acetyl]amino]acetyl]amino]acetyl]amino]ethyl]carbamate is CC(C)OC(=O)NCCNC(=O)CNC(=O)CNC(=O)CNC(C)(C)C.
What is the InChIKey of propan-2-yl N-[2-[[2-[[2-[[2-(tert-butylamino)acetyl]amino]acetyl]amino]acetyl]amino]ethyl]carbamate?
The InChIKey is BICYVLFKLXHCKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31N5O5/c1-11(2)26-15(25)18-7-6-17-12(22)8-19-13(23)9-20-14(24)10-21-16(3,4)5/h11,21H,6-10H2,1-5H3,(H,17,22)(H,18,25)(H,19,23)(H,20,24).
What are the key properties of propan-2-yl N-[2-[[2-[[2-[[2-(tert-butylamino)acetyl]amino]acetyl]amino]acetyl]amino]ethyl]carbamate?
propan-2-yl N-[2-[[2-[[2-[[2-(tert-butylamino)acetyl]amino]acetyl]amino]acetyl]amino]ethyl]carbamate has a molecular weight of 373.45 g/mol, XLogP of -1.14, 10 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-[2-[[2-[[2-[[2-(tert-butylamino)acetyl]amino]acetyl]amino]acetyl]amino]ethyl]carbamate is sourced from PubChem (CID 138630558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).