C12H11N2O2PS3 — CID 138630627
[2,6-dimethyl-4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanylmethyl]phenyl]-phosphorosomethanone (PubChem CID 138630627) has the molecular formula C12H11N2O2PS3 and a molecular weight of 342.41 g/mol. Its IUPAC name is [2,6-dimethyl-4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanylmethyl]phenyl]-phosphorosomethanone.
| Compound Name | [2,6-dimethyl-4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanylmethyl]phenyl]-phosphorosomethanone |
|---|---|
| PubChem CID | 138630627 |
| Molecular Formula | C12H11N2O2PS3 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | [2,6-dimethyl-4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanylmethyl]phenyl]-phosphorosomethanone |
| SMILES | Cc1cc(CSc2n[nH]c(=S)s2)cc(C)c1C(=O)P=O |
| InChI | InChI=1S/C12H11N2O2PS3/c1-6-3-8(4-7(2)9(6)10(15)17-16)5-19-12-14-13-11(18)20-12/h3-4H,5H2,1-2H3,(H,13,18) |
| InChIKey | ILLCCDBQDYWDMD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|