About N-(4-methoxycyclohexa-2,5-dien-1-yl)acetamide
N-(4-methoxycyclohexa-2,5-dien-1-yl)acetamide (PubChem CID 138630718) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is N-(4-methoxycyclohexa-2,5-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(4-methoxycyclohexa-2,5-dien-1-yl)acetamide |
| PubChem CID | 138630718 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | N-(4-methoxycyclohexa-2,5-dien-1-yl)acetamide |
| SMILES | COC1C=CC(NC(C)=O)C=C1 |
| InChI | InChI=1S/C9H13NO2/c1-7(11)10-8-3-5-9(12-2)6-4-8/h3-6,8-9H,1-2H3,(H,10,11) |
| InChIKey | YDORPEZXYFEUBT-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(4-methoxycyclohexa-2,5-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methoxycyclohexa-2,5-dien-1-yl)acetamide?
The IUPAC name of N-(4-methoxycyclohexa-2,5-dien-1-yl)acetamide (CID 138630718) is N-(4-methoxycyclohexa-2,5-dien-1-yl)acetamide.
What is the SMILES notation for N-(4-methoxycyclohexa-2,5-dien-1-yl)acetamide?
The canonical SMILES for N-(4-methoxycyclohexa-2,5-dien-1-yl)acetamide is COC1C=CC(NC(C)=O)C=C1.
What is the InChIKey of N-(4-methoxycyclohexa-2,5-dien-1-yl)acetamide?
The InChIKey is YDORPEZXYFEUBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c1-7(11)10-8-3-5-9(12-2)6-4-8/h3-6,8-9H,1-2H3,(H,10,11).
What are the key properties of N-(4-methoxycyclohexa-2,5-dien-1-yl)acetamide?
N-(4-methoxycyclohexa-2,5-dien-1-yl)acetamide has a molecular weight of 167.21 g/mol, XLogP of 0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methoxycyclohexa-2,5-dien-1-yl)acetamide is sourced from PubChem (CID 138630718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).