C30H36F3N7O2 — CID 138630860
methyl 2-[[3-[1-amino-2,2,2-trifluoro-1-(methylamino)ethyl]phenyl]methyl]-4-(3-piperidin-1-ylpropylamino)-9H-pyrimido[4,5-b]indole-7-carboxylate (PubChem CID 138630860) has the molecular formula C30H36F3N7O2 and a molecular weight of 583.66 g/mol. Its IUPAC name is methyl 2-[[3-[1-amino-2,2,2-trifluoro-1-(methylamino)ethyl]phenyl]methyl]-4-(3-piperidin-1-ylpropylamino)-9H-pyrimido[4,5-b]indole-7-carboxylate.
| Compound Name | methyl 2-[[3-[1-amino-2,2,2-trifluoro-1-(methylamino)ethyl]phenyl]methyl]-4-(3-piperidin-1-ylpropylamino)-9H-pyrimido[4,5-b]indole-7-carboxylate |
|---|---|
| PubChem CID | 138630860 |
| Molecular Formula | C30H36F3N7O2 |
| Molecular Weight | 583.66 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | methyl 2-[[3-[1-amino-2,2,2-trifluoro-1-(methylamino)ethyl]phenyl]methyl]-4-(3-piperidin-1-ylpropylamino)-9H-pyrimido[4,5-b]indole-7-carboxylate |
| SMILES | CNC(N)(c1cccc(Cc2nc(NCCCN3CCCCC3)c3c(n2)[nH]c2cc(C(=O)OC)ccc23)c1)C(F)(F)F |
| InChI | InChI=1S/C30H36F3N7O2/c1-35-29(34,30(31,32)33)21-9-6-8-19(16-21)17-24-38-26(36-12-7-15-40-13-4-3-5-14-40)25-22-11-10-20(28(41)42-2)18-23(22)37-27(25)39-24/h6,8-11,16,18,35H,3-5,7,12-15,17,34H2,1-2H3,(H2,36,37,38,39) |
| InChIKey | QNOSZYLDXPAYGT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.66 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|