C19H27N — CID 138630908
(3Z)-8-methyl-9-[(5Z)-4-prop-2-enylhepta-2,3,5-trien-2-yl]-5,6,7,8-tetrahydro-2H-azonine (PubChem CID 138630908) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is (3Z)-8-methyl-9-[(5Z)-4-prop-2-enylhepta-2,3,5-trien-2-yl]-5,6,7,8-tetrahydro-2H-azonine.
| Compound Name | (3Z)-8-methyl-9-[(5Z)-4-prop-2-enylhepta-2,3,5-trien-2-yl]-5,6,7,8-tetrahydro-2H-azonine |
|---|---|
| PubChem CID | 138630908 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | (3Z)-8-methyl-9-[(5Z)-4-prop-2-enylhepta-2,3,5-trien-2-yl]-5,6,7,8-tetrahydro-2H-azonine |
| SMILES | C=CCC(=C=C(C)/C1=N/C/C=C\CCCC1C)/C=C\C |
| InChI | InChI=1S/C19H27N/c1-5-11-18(12-6-2)15-17(4)19-16(3)13-9-7-8-10-14-20-19/h5-6,8,10,12,16H,1,7,9,11,13-14H2,2-4H3/b10-8-,12-6-,20-19+ |
| InChIKey | FRWQHWOUANXRPL-ATWZFGHCSA-N |
| XLogP | 5.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|