About (Z)-2-hydrazinyl-2-(7-methylcyclohepta-1,3,6-trien-1-yl)ethenamine
(Z)-2-hydrazinyl-2-(7-methylcyclohepta-1,3,6-trien-1-yl)ethenamine (PubChem CID 138631007) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is (Z)-2-hydrazinyl-2-(7-methylcyclohepta-1,3,6-trien-1-yl)ethenamine.
Molecular Properties
| Compound Name | (Z)-2-hydrazinyl-2-(7-methylcyclohepta-1,3,6-trien-1-yl)ethenamine |
| PubChem CID | 138631007 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | (Z)-2-hydrazinyl-2-(7-methylcyclohepta-1,3,6-trien-1-yl)ethenamine |
| SMILES | CC1=CCC=CC=C1/C(=C/N)NN |
| InChI | InChI=1S/C10H15N3/c1-8-5-3-2-4-6-9(8)10(7-11)13-12/h2,4-7,13H,3,11-12H2,1H3/b10-7- |
| InChIKey | WMVXPGVXNKOHJR-YFHOEESVSA-N |
| XLogP | 1.08 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-hydrazinyl-2-(7-methylcyclohepta-1,3,6-trien-1-yl)ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-hydrazinyl-2-(7-methylcyclohepta-1,3,6-trien-1-yl)ethenamine?
The IUPAC name of (Z)-2-hydrazinyl-2-(7-methylcyclohepta-1,3,6-trien-1-yl)ethenamine (CID 138631007) is (Z)-2-hydrazinyl-2-(7-methylcyclohepta-1,3,6-trien-1-yl)ethenamine.
What is the SMILES notation for (Z)-2-hydrazinyl-2-(7-methylcyclohepta-1,3,6-trien-1-yl)ethenamine?
The canonical SMILES for (Z)-2-hydrazinyl-2-(7-methylcyclohepta-1,3,6-trien-1-yl)ethenamine is CC1=CCC=CC=C1/C(=C/N)NN.
What is the InChIKey of (Z)-2-hydrazinyl-2-(7-methylcyclohepta-1,3,6-trien-1-yl)ethenamine?
The InChIKey is WMVXPGVXNKOHJR-YFHOEESVSA-N. The full InChI is InChI=1S/C10H15N3/c1-8-5-3-2-4-6-9(8)10(7-11)13-12/h2,4-7,13H,3,11-12H2,1H3/b10-7-.
What are the key properties of (Z)-2-hydrazinyl-2-(7-methylcyclohepta-1,3,6-trien-1-yl)ethenamine?
(Z)-2-hydrazinyl-2-(7-methylcyclohepta-1,3,6-trien-1-yl)ethenamine has a molecular weight of 177.25 g/mol, XLogP of 1.08, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-hydrazinyl-2-(7-methylcyclohepta-1,3,6-trien-1-yl)ethenamine is sourced from PubChem (CID 138631007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).