C11H19N3 — CID 138631013
(Z)-3-[(1E,4Z)-cycloocta-1,4-dien-1-yl]-3-hydrazinylprop-2-en-1-amine (PubChem CID 138631013) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is (Z)-3-[(1E,4Z)-cycloocta-1,4-dien-1-yl]-3-hydrazinylprop-2-en-1-amine.
| Compound Name | (Z)-3-[(1E,4Z)-cycloocta-1,4-dien-1-yl]-3-hydrazinylprop-2-en-1-amine |
|---|---|
| PubChem CID | 138631013 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (Z)-3-[(1E,4Z)-cycloocta-1,4-dien-1-yl]-3-hydrazinylprop-2-en-1-amine |
| SMILES | NC/C=C(NN)/C1=C/C/C=C\CCC1 |
| InChI | InChI=1S/C11H19N3/c12-9-8-11(14-13)10-6-4-2-1-3-5-7-10/h1-2,6,8,14H,3-5,7,9,12-13H2/b2-1-,10-6+,11-8- |
| InChIKey | CYYQIDCJKQGHAV-KMZIUMRMSA-N |
| XLogP | 1.35 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|