About 5-[(Z)-2-amino-1-hydrazinylethenyl]-2,4-dibromophenol
5-[(Z)-2-amino-1-hydrazinylethenyl]-2,4-dibromophenol (PubChem CID 138631109) has the molecular formula C8H9Br2N3O
and a molecular weight of 322.99 g/mol. Its IUPAC name is 5-[(Z)-2-amino-1-hydrazinylethenyl]-2,4-dibromophenol.
Molecular Properties
| Compound Name | 5-[(Z)-2-amino-1-hydrazinylethenyl]-2,4-dibromophenol |
| PubChem CID | 138631109 |
| Molecular Formula | C8H9Br2N3O |
| Molecular Weight | 322.99 g/mol |
| Exact Mass | 320.91 |
| IUPAC Name | 5-[(Z)-2-amino-1-hydrazinylethenyl]-2,4-dibromophenol |
| SMILES | N/C=C(\NN)c1cc(O)c(Br)cc1Br |
| InChI | InChI=1S/C8H9Br2N3O/c9-5-2-6(10)8(14)1-4(5)7(3-11)13-12/h1-3,13-14H,11-12H2/b7-3- |
| InChIKey | BHVKWXMIWSJFIG-CLTKARDFSA-N |
| XLogP | 1.64 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.99 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(Z)-2-amino-1-hydrazinylethenyl]-2,4-dibromophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-2-amino-1-hydrazinylethenyl]-2,4-dibromophenol?
The IUPAC name of 5-[(Z)-2-amino-1-hydrazinylethenyl]-2,4-dibromophenol (CID 138631109) is 5-[(Z)-2-amino-1-hydrazinylethenyl]-2,4-dibromophenol.
What is the SMILES notation for 5-[(Z)-2-amino-1-hydrazinylethenyl]-2,4-dibromophenol?
The canonical SMILES for 5-[(Z)-2-amino-1-hydrazinylethenyl]-2,4-dibromophenol is N/C=C(\NN)c1cc(O)c(Br)cc1Br.
What is the InChIKey of 5-[(Z)-2-amino-1-hydrazinylethenyl]-2,4-dibromophenol?
The InChIKey is BHVKWXMIWSJFIG-CLTKARDFSA-N. The full InChI is InChI=1S/C8H9Br2N3O/c9-5-2-6(10)8(14)1-4(5)7(3-11)13-12/h1-3,13-14H,11-12H2/b7-3-.
What are the key properties of 5-[(Z)-2-amino-1-hydrazinylethenyl]-2,4-dibromophenol?
5-[(Z)-2-amino-1-hydrazinylethenyl]-2,4-dibromophenol has a molecular weight of 322.99 g/mol, XLogP of 1.64, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-2-amino-1-hydrazinylethenyl]-2,4-dibromophenol is sourced from PubChem (CID 138631109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).