About (Z)-2-(5,6-dihydro-1H-inden-2-yl)-2-hydrazinylethenamine
(Z)-2-(5,6-dihydro-1H-inden-2-yl)-2-hydrazinylethenamine (PubChem CID 138631145) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is (Z)-2-(5,6-dihydro-1H-inden-2-yl)-2-hydrazinylethenamine.
Molecular Properties
| Compound Name | (Z)-2-(5,6-dihydro-1H-inden-2-yl)-2-hydrazinylethenamine |
| PubChem CID | 138631145 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | (Z)-2-(5,6-dihydro-1H-inden-2-yl)-2-hydrazinylethenamine |
| SMILES | N/C=C(\NN)C1=CC2=CCCC=C2C1 |
| InChI | InChI=1S/C11H15N3/c12-7-11(14-13)10-5-8-3-1-2-4-9(8)6-10/h3-5,7,14H,1-2,6,12-13H2/b11-7- |
| InChIKey | MOQVQYPBGQRFSO-XFFZJAGNSA-N |
| XLogP | 1.23 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(5,6-dihydro-1H-inden-2-yl)-2-hydrazinylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(5,6-dihydro-1H-inden-2-yl)-2-hydrazinylethenamine?
The IUPAC name of (Z)-2-(5,6-dihydro-1H-inden-2-yl)-2-hydrazinylethenamine (CID 138631145) is (Z)-2-(5,6-dihydro-1H-inden-2-yl)-2-hydrazinylethenamine.
What is the SMILES notation for (Z)-2-(5,6-dihydro-1H-inden-2-yl)-2-hydrazinylethenamine?
The canonical SMILES for (Z)-2-(5,6-dihydro-1H-inden-2-yl)-2-hydrazinylethenamine is N/C=C(\NN)C1=CC2=CCCC=C2C1.
What is the InChIKey of (Z)-2-(5,6-dihydro-1H-inden-2-yl)-2-hydrazinylethenamine?
The InChIKey is MOQVQYPBGQRFSO-XFFZJAGNSA-N. The full InChI is InChI=1S/C11H15N3/c12-7-11(14-13)10-5-8-3-1-2-4-9(8)6-10/h3-5,7,14H,1-2,6,12-13H2/b11-7-.
What are the key properties of (Z)-2-(5,6-dihydro-1H-inden-2-yl)-2-hydrazinylethenamine?
(Z)-2-(5,6-dihydro-1H-inden-2-yl)-2-hydrazinylethenamine has a molecular weight of 189.26 g/mol, XLogP of 1.23, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(5,6-dihydro-1H-inden-2-yl)-2-hydrazinylethenamine is sourced from PubChem (CID 138631145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).