C10H15NO — CID 138631285
(3Z,6E)-6-[(E)-2-aminoethenyl]octa-1,3,6-trien-2-ol (PubChem CID 138631285) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (3Z,6E)-6-[(E)-2-aminoethenyl]octa-1,3,6-trien-2-ol.
| Compound Name | (3Z,6E)-6-[(E)-2-aminoethenyl]octa-1,3,6-trien-2-ol |
|---|---|
| PubChem CID | 138631285 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (3Z,6E)-6-[(E)-2-aminoethenyl]octa-1,3,6-trien-2-ol |
| SMILES | C=C(O)/C=C\CC(/C=C/N)=C\C |
| InChI | InChI=1S/C10H15NO/c1-3-10(7-8-11)6-4-5-9(2)12/h3-5,7-8,12H,2,6,11H2,1H3/b5-4-,8-7+,10-3+ |
| InChIKey | QWBRWFITULATHJ-GXAHDBCWSA-N |
| XLogP | 2.42 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|