C10H17NS — CID 138631757
N,N-dimethyl-4-methylsulfanylhepta-1,2,6-trien-3-amine (PubChem CID 138631757) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is N,N-dimethyl-4-methylsulfanylhepta-1,2,6-trien-3-amine.
| Compound Name | N,N-dimethyl-4-methylsulfanylhepta-1,2,6-trien-3-amine |
|---|---|
| PubChem CID | 138631757 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | N,N-dimethyl-4-methylsulfanylhepta-1,2,6-trien-3-amine |
| SMILES | C=C=C(C(CC=C)SC)N(C)C |
| InChI | InChI=1S/C10H17NS/c1-6-8-10(12-5)9(7-2)11(3)4/h6,10H,1-2,8H2,3-5H3 |
| InChIKey | QSGZXNSHTZJIBJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|