C23H19FN6OS2 — CID 138631843
3-[5-[2-[2-[(4-fluorophenyl)sulfanylamino]ethylamino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenol (PubChem CID 138631843) has the molecular formula C23H19FN6OS2 and a molecular weight of 478.58 g/mol. Its IUPAC name is 3-[5-[2-[2-[(4-fluorophenyl)sulfanylamino]ethylamino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenol.
| Compound Name | 3-[5-[2-[2-[(4-fluorophenyl)sulfanylamino]ethylamino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenol |
|---|---|
| PubChem CID | 138631843 |
| Molecular Formula | C23H19FN6OS2 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 3-[5-[2-[2-[(4-fluorophenyl)sulfanylamino]ethylamino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenol |
| SMILES | Oc1cccc(-c2nc3sccn3c2-c2ccnc(NCCNSc3ccc(F)cc3)n2)c1 |
| InChI | InChI=1S/C23H19FN6OS2/c24-16-4-6-18(7-5-16)33-27-11-10-26-22-25-9-8-19(28-22)21-20(15-2-1-3-17(31)14-15)29-23-30(21)12-13-32-23/h1-9,12-14,27,31H,10-11H2,(H,25,26,28) |
| InChIKey | HPARBWRRQXFXLD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 87.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|