C25H29N7O5S2 — CID 138631851
tert-butyl 6-[2-[[4-[6-(3-hydroxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]-1,1-dioxo-1,2,6-thiadiazinane-2-carboxylate (PubChem CID 138631851) has the molecular formula C25H29N7O5S2 and a molecular weight of 571.69 g/mol. Its IUPAC name is tert-butyl 6-[2-[[4-[6-(3-hydroxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]-1,1-dioxo-1,2,6-thiadiazinane-2-carboxylate.
| Compound Name | tert-butyl 6-[2-[[4-[6-(3-hydroxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]-1,1-dioxo-1,2,6-thiadiazinane-2-carboxylate |
|---|---|
| PubChem CID | 138631851 |
| Molecular Formula | C25H29N7O5S2 |
| Molecular Weight | 571.69 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | tert-butyl 6-[2-[[4-[6-(3-hydroxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]-1,1-dioxo-1,2,6-thiadiazinane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(CCNc2nccc(-c3c(-c4cccc(O)c4)nc4sccn34)n2)S1(=O)=O |
| InChI | InChI=1S/C25H29N7O5S2/c1-25(2,3)37-24(34)32-12-5-11-30(39(32,35)36)13-10-27-22-26-9-8-19(28-22)21-20(17-6-4-7-18(33)16-17)29-23-31(21)14-15-38-23/h4,6-9,14-16,33H,5,10-13H2,1-3H3,(H,26,27,28) |
| InChIKey | UCDZZJRQPSSNHD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 142.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.69 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |