C14H24N4 — CID 138631919
N-methyl-1-[(4R,5R,6S)-12-propan-2-yl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methanamine (PubChem CID 138631919) has the molecular formula C14H24N4 and a molecular weight of 248.37 g/mol. Its IUPAC name is N-methyl-1-[(4R,5R,6S)-12-propan-2-yl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methanamine.
| Compound Name | N-methyl-1-[(4R,5R,6S)-12-propan-2-yl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methanamine |
|---|---|
| PubChem CID | 138631919 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | N-methyl-1-[(4R,5R,6S)-12-propan-2-yl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methanamine |
| SMILES | CNC[C@@H]1[C@@H]2CCc3c(nnn3C(C)C)CC[C@@H]21 |
| InChI | InChI=1S/C14H24N4/c1-9(2)18-14-7-5-11-10(12(11)8-15-3)4-6-13(14)16-17-18/h9-12,15H,4-8H2,1-3H3/t10-,11+,12-/m0/s1 |
| InChIKey | WRFLERYQYYRRKH-TUAOUCFPSA-N |
| XLogP | 1.82 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |