C20H21N7O3S2 — CID 138632019
3-[5-[2-[2-(1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethylamino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenol (PubChem CID 138632019) has the molecular formula C20H21N7O3S2 and a molecular weight of 471.57 g/mol. Its IUPAC name is 3-[5-[2-[2-(1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethylamino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenol.
| Compound Name | 3-[5-[2-[2-(1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethylamino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenol |
|---|---|
| PubChem CID | 138632019 |
| Molecular Formula | C20H21N7O3S2 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 3-[5-[2-[2-(1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethylamino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenol |
| SMILES | O=S1(=O)NCCCN1CCNc1nccc(-c2c(-c3cccc(O)c3)nc3sccn23)n1 |
| InChI | InChI=1S/C20H21N7O3S2/c28-15-4-1-3-14(13-15)17-18(27-11-12-31-20(27)25-17)16-5-7-21-19(24-16)22-8-10-26-9-2-6-23-32(26,29)30/h1,3-5,7,11-13,23,28H,2,6,8-10H2,(H,21,22,24) |
| InChIKey | DOPSOTASKNWJRT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 124.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |