C19H25F3O2 — CID 138632140
(3Z,5Z)-4-[(2Z)-2-(1-propoxyethenyl)hexa-2,5-dienoxy]-3-(trifluoromethyl)hepta-1,3,5-triene (PubChem CID 138632140) has the molecular formula C19H25F3O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is (3Z,5Z)-4-[(2Z)-2-(1-propoxyethenyl)hexa-2,5-dienoxy]-3-(trifluoromethyl)hepta-1,3,5-triene.
| Compound Name | (3Z,5Z)-4-[(2Z)-2-(1-propoxyethenyl)hexa-2,5-dienoxy]-3-(trifluoromethyl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 138632140 |
| Molecular Formula | C19H25F3O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (3Z,5Z)-4-[(2Z)-2-(1-propoxyethenyl)hexa-2,5-dienoxy]-3-(trifluoromethyl)hepta-1,3,5-triene |
| SMILES | C=CC/C=C(/COC(/C=C\C)=C(/C=C)C(F)(F)F)C(=C)OCCC |
| InChI | InChI=1S/C19H25F3O2/c1-6-10-12-16(15(5)23-13-8-3)14-24-18(11-7-2)17(9-4)19(20,21)22/h6-7,9,11-12H,1,4-5,8,10,13-14H2,2-3H3/b11-7-,16-12-,18-17- |
| InChIKey | PNHKWWVRCLHEOE-YEJSOXOQSA-N |
| XLogP | 6.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|