C20H23Cl2FN2O4 — CID 138632361
2-(4-chloro-3-fluorophenoxy)-N-[4-[2-(4-chlorophenoxy)ethylamino]-3-hydroxybutyl]acetamide (PubChem CID 138632361) has the molecular formula C20H23Cl2FN2O4 and a molecular weight of 445.32 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenoxy)-N-[4-[2-(4-chlorophenoxy)ethylamino]-3-hydroxybutyl]acetamide.
| Compound Name | 2-(4-chloro-3-fluorophenoxy)-N-[4-[2-(4-chlorophenoxy)ethylamino]-3-hydroxybutyl]acetamide |
|---|---|
| PubChem CID | 138632361 |
| Molecular Formula | C20H23Cl2FN2O4 |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 2-(4-chloro-3-fluorophenoxy)-N-[4-[2-(4-chlorophenoxy)ethylamino]-3-hydroxybutyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)c(F)c1)NCCC(O)CNCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H23Cl2FN2O4/c21-14-1-3-16(4-2-14)28-10-9-24-12-15(26)7-8-25-20(27)13-29-17-5-6-18(22)19(23)11-17/h1-6,11,15,24,26H,7-10,12-13H2,(H,25,27) |
| InChIKey | ZTZAUQJFRTYNAQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|