C27H23NO4 — CID 138632552
2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-[(E)-2-(4-ethenyl-3,5-dimethoxyphenyl)ethenyl]benzonitrile (PubChem CID 138632552) has the molecular formula C27H23NO4 and a molecular weight of 425.48 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-[(E)-2-(4-ethenyl-3,5-dimethoxyphenyl)ethenyl]benzonitrile.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-[(E)-2-(4-ethenyl-3,5-dimethoxyphenyl)ethenyl]benzonitrile |
|---|---|
| PubChem CID | 138632552 |
| Molecular Formula | C27H23NO4 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-[(E)-2-(4-ethenyl-3,5-dimethoxyphenyl)ethenyl]benzonitrile |
| SMILES | C=Cc1c(OC)cc(/C=C/c2cccc(-c3ccc4c(c3)OCCO4)c2C#N)cc1OC |
| InChI | InChI=1S/C27H23NO4/c1-4-21-25(29-2)14-18(15-26(21)30-3)8-9-19-6-5-7-22(23(19)17-28)20-10-11-24-27(16-20)32-13-12-31-24/h4-11,14-16H,1,12-13H2,2-3H3/b9-8+ |
| InChIKey | QGTHQUCKYHOBQW-CMDGGOBGSA-N |
| XLogP | 5.83 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|