C26H29NO2 — CID 138632869
2-[[3-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methylamino]propane-1,3-diol (PubChem CID 138632869) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is 2-[[3-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methylamino]propane-1,3-diol.
| Compound Name | 2-[[3-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 138632869 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 2-[[3-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methylamino]propane-1,3-diol |
| SMILES | Cc1cc(CNC(CO)CO)ccc1/C=C/c1cccc(-c2ccccc2)c1C |
| InChI | InChI=1S/C26H29NO2/c1-19-15-21(16-27-25(17-28)18-29)11-12-22(19)13-14-23-9-6-10-26(20(23)2)24-7-4-3-5-8-24/h3-15,25,27-29H,16-18H2,1-2H3/b14-13+ |
| InChIKey | LTAFHYNESOQVIE-BUHFOSPRSA-N |
| XLogP | 4.58 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|