C24H18F7N3 — CID 138633839
6-fluoro-4-[4-[(1R)-2,2,2-trifluoro-1-(4,6,7-trifluoro-1H-benzimidazol-2-yl)ethyl]cyclohexyl]quinoline (PubChem CID 138633839) has the molecular formula C24H18F7N3 and a molecular weight of 481.42 g/mol. Its IUPAC name is 6-fluoro-4-[4-[(1R)-2,2,2-trifluoro-1-(4,6,7-trifluoro-1H-benzimidazol-2-yl)ethyl]cyclohexyl]quinoline.
| Compound Name | 6-fluoro-4-[4-[(1R)-2,2,2-trifluoro-1-(4,6,7-trifluoro-1H-benzimidazol-2-yl)ethyl]cyclohexyl]quinoline |
|---|---|
| PubChem CID | 138633839 |
| Molecular Formula | C24H18F7N3 |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 6-fluoro-4-[4-[(1R)-2,2,2-trifluoro-1-(4,6,7-trifluoro-1H-benzimidazol-2-yl)ethyl]cyclohexyl]quinoline |
| SMILES | Fc1ccc2nccc(C3CCC([C@H](c4nc5c(F)cc(F)c(F)c5[nH]4)C(F)(F)F)CC3)c2c1 |
| InChI | InChI=1S/C24H18F7N3/c25-13-5-6-18-15(9-13)14(7-8-32-18)11-1-3-12(4-2-11)19(24(29,30)31)23-33-21-17(27)10-16(26)20(28)22(21)34-23/h5-12,19H,1-4H2,(H,33,34)/t11?,12?,19-/m1/s1 |
| InChIKey | MVWOKCNGRFYUEQ-ZYYDUNOVSA-N |
| XLogP | 7.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|