About (1S)-2,2-dimethyl-5,5-bis(2-methylprop-2-enyl)cyclopentan-1-ol
(1S)-2,2-dimethyl-5,5-bis(2-methylprop-2-enyl)cyclopentan-1-ol (PubChem CID 138633999) has the molecular formula C15H26O
and a molecular weight of 222.37 g/mol. Its IUPAC name is (1S)-2,2-dimethyl-5,5-bis(2-methylprop-2-enyl)cyclopentan-1-ol.
Molecular Properties
| Compound Name | (1S)-2,2-dimethyl-5,5-bis(2-methylprop-2-enyl)cyclopentan-1-ol |
| PubChem CID | 138633999 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | (1S)-2,2-dimethyl-5,5-bis(2-methylprop-2-enyl)cyclopentan-1-ol |
| SMILES | C=C(C)CC1(CC(=C)C)CCC(C)(C)[C@@H]1O |
| InChI | InChI=1S/C15H26O/c1-11(2)9-15(10-12(3)4)8-7-14(5,6)13(15)16/h13,16H,1,3,7-10H2,2,4-6H3/t13-/m0/s1 |
| InChIKey | CEPPTTOLBSMUME-ZDUSSCGKSA-N |
| XLogP | 4.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S)-2,2-dimethyl-5,5-bis(2-methylprop-2-enyl)cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2,2-dimethyl-5,5-bis(2-methylprop-2-enyl)cyclopentan-1-ol?
The IUPAC name of (1S)-2,2-dimethyl-5,5-bis(2-methylprop-2-enyl)cyclopentan-1-ol (CID 138633999) is (1S)-2,2-dimethyl-5,5-bis(2-methylprop-2-enyl)cyclopentan-1-ol.
What is the SMILES notation for (1S)-2,2-dimethyl-5,5-bis(2-methylprop-2-enyl)cyclopentan-1-ol?
The canonical SMILES for (1S)-2,2-dimethyl-5,5-bis(2-methylprop-2-enyl)cyclopentan-1-ol is C=C(C)CC1(CC(=C)C)CCC(C)(C)[C@@H]1O.
What is the InChIKey of (1S)-2,2-dimethyl-5,5-bis(2-methylprop-2-enyl)cyclopentan-1-ol?
The InChIKey is CEPPTTOLBSMUME-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H26O/c1-11(2)9-15(10-12(3)4)8-7-14(5,6)13(15)16/h13,16H,1,3,7-10H2,2,4-6H3/t13-/m0/s1.
What are the key properties of (1S)-2,2-dimethyl-5,5-bis(2-methylprop-2-enyl)cyclopentan-1-ol?
(1S)-2,2-dimethyl-5,5-bis(2-methylprop-2-enyl)cyclopentan-1-ol has a molecular weight of 222.37 g/mol, XLogP of 4.09, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2,2-dimethyl-5,5-bis(2-methylprop-2-enyl)cyclopentan-1-ol is sourced from PubChem (CID 138633999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).