C17H10F3N3O3 — CID 138634201
3-oxo-2-phenyl-6-[6-(trifluoromethyl)-3-pyridinyl]pyridazine-4-carboxylic acid (PubChem CID 138634201) has the molecular formula C17H10F3N3O3 and a molecular weight of 361.28 g/mol. Its IUPAC name is 3-oxo-2-phenyl-6-[6-(trifluoromethyl)-3-pyridinyl]pyridazine-4-carboxylic acid.
| Compound Name | 3-oxo-2-phenyl-6-[6-(trifluoromethyl)-3-pyridinyl]pyridazine-4-carboxylic acid |
|---|---|
| PubChem CID | 138634201 |
| Molecular Formula | C17H10F3N3O3 |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 3-oxo-2-phenyl-6-[6-(trifluoromethyl)-3-pyridinyl]pyridazine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(C(F)(F)F)nc2)nn(-c2ccccc2)c1=O |
| InChI | InChI=1S/C17H10F3N3O3/c18-17(19,20)14-7-6-10(9-21-14)13-8-12(16(25)26)15(24)23(22-13)11-4-2-1-3-5-11/h1-9H,(H,25,26) |
| InChIKey | DMMJSFAAGGWDDO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |