C8H11N3O — CID 138634521
1,2,3,5-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 138634521) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 1,2,3,5-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | 1,2,3,5-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 138634521 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 1,2,3,5-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | NC(=O)C1CN2CC=CC=C2N1 |
| InChI | InChI=1S/C8H11N3O/c9-8(12)6-5-11-4-2-1-3-7(11)10-6/h1-3,6,10H,4-5H2,(H2,9,12) |
| InChIKey | ZRZTYGIBIMXMRQ-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |